Ganoderenic acid D
IUPAC name: 6-(7-hydroxy-4,4,10,13,14-pentamethyl-3,11,15-trioxo-1,2,5,6,7,12,16,17-octahydrocyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxohept-5-enoic acid
CAS Number: 100665-43-8
Class: Terpenoid
Mushrooms contain this compound
1 mushrooms
| MushID |
Thai name |
Common name |
Scientific name |
Family |
| 1 |
เห็ดหลินจือ |
Lingzhi |
Ganoderma lucidum ( Curtis ) P. Karst. |
Ganodermataceae |
2D Structure
Compound Properties
SMILES
O=C(CC(C(=O)O)C)/C=C(\C1CC(=O)C2(C1(C)CC(=O)C1=C2C(O)CC2C1(C)CCC(=O)C2(C)C)C)/C
Physicochemical Properties
| Formula |
C30H40O7 |
| Molecular wieght(g/mol) |
512.63 |
| Num. of Heavy atoms |
37 |
| Num. of Aromatic Heavy atoms |
0 |
| Fraction Csp3 |
0.70 |
| Num. of Rotatable bonds |
5 |
| Num. of H-bond acceptors |
7 |
| Num. of H-bonds donors |
2 |
| Molar Refractivity |
139.61 |
| TPSA (square Angstrom) |
125.81 |
Lipophilicity
| iLOGP |
2.58 |
| XLOGP3 |
2.04 |
| WLOGP |
4.26 |
| MLOGP |
2.09 |
| Silicos-IT LOGP |
5.41 |
| Consensus LOGP |
3.28 |
Water Solubility
| ESOL |
|
| LogS |
-3.97 |
Solubility(mg/ml) |
5.45E-02 |
Solubility(mol/l) |
1.06E-04 |
Class |
Soluble |
| Ali |
|
| LogS |
-4.31 |
Solubility(mg/ml) |
2.51E-02 |
Solubility(mol/l) |
4.90E-05 |
Class |
Moderately soluble |
| Silicos-IT |
|
| LogS |
-5.30 |
Solubility(mg/ml) |
2.55E-03 |
Solubility(mol/l) |
4.97E-06 |
Class |
Moderately soluble |
Pharmacokinetics
| GI absorbtion |
Low |
| BBB permeant |
No |
| Pgp substrate |
Yes |
| CYP1A2 inhibitor |
No |
| CYP2C19 inhibitor |
No |
| CYP2C9 inhibitor |
No |
| CYP2D6 inhibitor |
No |
| CYP3A4 inhibitor |
No |
| Log Kp (skin permeation) (cm/s) |
-7.98 |
Druglikeness
| Lipinski Num. violations |
1 |
| Ghose Num. violations |
3 |
| Veber Num. violations |
0 |
| Egan Num. violations |
0 |
| Muegge Num. violations |
0 |
| Bioavailability Score |
0.56 |
Medicinal Chemistry
| PAINS Num. of alerts |
0 |
| Brenk Num. of alerts |
1 |
| Leadlikeness Num. of violations |
1 |
| Synthetic Accessibility |
6.26 |
Biological Activity
| Biological Activity |
JID |
| Anticancer |
8 |
| Cytotoxicity |
8 |
| Anti-HIV |
8 |
| Antitumour |
8 |
| Hypotensive |
8 |
| Antiplatelet aggregation |
8 |
| Antihypertension |
8 |
| Hypocholesterolemic |
8 |
| Antioxidant |
8 |
| Antibacterial |
8 |
| Hepatoprotective |
8 |
| Antiallergic |
8 |
| Enzyme inhibitors |
8 |
