ganoderic acid O
IUPAC name: 6-hydroxy-2-methyl-4-oxo-6-(4,4,10,13,14-pentamethyl-3,7,11,15-tetraoxo-2,5,6,12,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl)heptanoic acid
CAS Number: 110241-21-9
Class: Terpenoid
Mushrooms contain this compound
1 mushrooms
| MushID |
Thai name |
Common name |
Scientific name |
Family |
| 1 |
เห็ดหลินจือ |
Lingzhi |
Ganoderma lucidum ( Curtis ) P. Karst. |
Ganodermataceae |
2D Structure
Compound Properties
SMILES
O=C(CC(C1CC(=O)C2(C1(C)CC(=O)C1=C2C(=O)CC2C1(C)CCC(=O)C2(C)C)C)(O)C)CC(C(=O)O)C
Physicochemical Properties
| Formula |
C30H40O8 |
| Molecular wieght(g/mol) |
528.63 |
| Num. of Heavy atoms |
38 |
| Num. of Aromatic Heavy atoms |
0 |
| Fraction Csp3 |
0.73 |
| Num. of Rotatable bonds |
6 |
| Num. of H-bond acceptors |
8 |
| Num. of H-bonds donors |
2 |
| Molar Refractivity |
140.33 |
| TPSA (square Angstrom) |
142.88 |
Lipophilicity
| iLOGP |
2.57 |
| XLOGP3 |
1.03 |
| WLOGP |
3.66 |
| MLOGP |
1.31 |
| Silicos-IT LOGP |
5.42 |
| Consensus LOGP |
2.80 |
Water Solubility
| ESOL |
|
| LogS |
-3.37 |
Solubility(mg/ml) |
2.25E-01 |
Solubility(mol/l) |
4.26E-04 |
Class |
Soluble |
| Ali |
|
| LogS |
-3.62 |
Solubility(mg/ml) |
1.27E-01 |
Solubility(mol/l) |
2.40E-04 |
Class |
Soluble |
| Silicos-IT |
|
| LogS |
-5.77 |
Solubility(mg/ml) |
9.02E-04 |
Solubility(mol/l) |
1.71E-06 |
Class |
Moderately soluble |
Pharmacokinetics
| GI absorbtion |
Low |
| BBB permeant |
No |
| Pgp substrate |
Yes |
| CYP1A2 inhibitor |
No |
| CYP2C19 inhibitor |
No |
| CYP2C9 inhibitor |
No |
| CYP2D6 inhibitor |
No |
| CYP3A4 inhibitor |
No |
| Log Kp (skin permeation) (cm/s) |
-8.79 |
Druglikeness
| Lipinski Num. violations |
1 |
| Ghose Num. violations |
3 |
| Veber Num. violations |
1 |
| Egan Num. violations |
1 |
| Muegge Num. violations |
0 |
| Bioavailability Score |
0.56 |
Medicinal Chemistry
| PAINS Num. of alerts |
0 |
| Brenk Num. of alerts |
0 |
| Leadlikeness Num. of violations |
1 |
| Synthetic Accessibility |
6.17 |
Biological Activity
| Biological Activity |
JID |
| Anticancer |
8 |
| Cytotoxicity |
8 |
| Anti-HIV |
8 |
| Antitumour |
8 |
| Hypotensive |
8 |
| Antiplatelet aggregation |
8 |
| Antihypertension |
8 |
| Hypocholesterolemic |
8 |
| Antioxidant |
8 |
| Antibacterial |
8 |
| Hepatoprotective |
8 |
| Antiallergic |
8 |
| Enzyme inhibitors |
8 |
