Methyl ganoderate B
IUPAC name: methyl (2R,6R)-6-[(3S,5R,7S,10S,13R,14R,17R)-3,7-dihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxo-heptanoate
CAS Number: 81907-65-5
Class: Terpenoid
Mushrooms contain this compound
1 mushrooms
| MushID |
Thai name |
Common name |
Scientific name |
Family |
| 1 |
เห็ดหลินจือ |
Lingzhi |
Ganoderma lucidum ( Curtis ) P. Karst. |
Ganodermataceae |
2D Structure
Compound Properties
SMILES
COC(=O)[C@@H](CC(=O)C[C@H]([C@H]1CC(=O)[C@@]2([C@]1(C)CC(=O)C1=C2[C@@H](O)C[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C)C
Physicochemical Properties
| Formula |
C31H46O7 |
| Molecular wieght(g/mol) |
530.69 |
| Num. of Heavy atoms |
38 |
| Num. of Aromatic Heavy atoms |
0 |
| Fraction Csp3 |
0.81 |
| Num. of Rotatable bonds |
7 |
| Num. of H-bond acceptors |
7 |
| Num. of H-bonds donors |
2 |
| Molar Refractivity |
145.37 |
| TPSA (square Angstrom) |
117.97 |
Lipophilicity
| iLOGP |
3.78 |
| XLOGP3 |
2.53 |
| WLOGP |
4.22 |
| MLOGP |
2.45 |
| Silicos-IT LOGP |
5.55 |
| Consensus LOGP |
3.71 |
Water Solubility
| ESOL |
|
| LogS |
-4.26 |
Solubility(mg/ml) |
2.90E-02 |
Solubility(mol/l) |
5.47E-05 |
Class |
Moderately soluble |
| Ali |
|
| LogS |
-4.65 |
Solubility(mg/ml) |
1.18E-02 |
Solubility(mol/l) |
2.22E-05 |
Class |
Moderately soluble |
| Silicos-IT |
|
| LogS |
-5.65 |
Solubility(mg/ml) |
1.18E-03 |
Solubility(mol/l) |
2.22E-06 |
Class |
Moderately soluble |
Pharmacokinetics
| GI absorbtion |
High |
| BBB permeant |
No |
| Pgp substrate |
Yes |
| CYP1A2 inhibitor |
No |
| CYP2C19 inhibitor |
No |
| CYP2C9 inhibitor |
No |
| CYP2D6 inhibitor |
No |
| CYP3A4 inhibitor |
Yes |
| Log Kp (skin permeation) (cm/s) |
-7.74 |
Druglikeness
| Lipinski Num. violations |
1 |
| Ghose Num. violations |
3 |
| Veber Num. violations |
0 |
| Egan Num. violations |
0 |
| Muegge Num. violations |
0 |
| Bioavailability Score |
0.55 |
Medicinal Chemistry
| PAINS Num. of alerts |
0 |
| Brenk Num. of alerts |
0 |
| Leadlikeness Num. of violations |
1 |
| Synthetic Accessibility |
6.54 |
Biological Activity
| Biological Activity |
JID |
| Antitumour |
7 |
| Anti-HIV |
7 |
| Hypoglycemic |
7 |
| Antiplatelet aggregation |
7 |
| Neuroprotective |
7 |
| Hepatoprotective |
7 |
| Antiobesity |
7 |
