n-Butyl ganoderate H
IUPAC name: butyl (6R)-6-[(3S,5R,10S,12S,13R,14R,17R)-12-acetyloxy-3-hydroxy-4,4,10,13,14-pentamethyl-7,11,15-trioxo-1,2,3,5,6,12,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxoheptanoate
CAS Number: CID_54754513
Class: Terpenoid
Mushrooms contain this compound
1 mushrooms
| MushID |
Thai name |
Common name |
Scientific name |
Family |
| 1 |
เห็ดหลินจือ |
Lingzhi |
Ganoderma lucidum ( Curtis ) P. Karst. |
Ganodermataceae |
2D Structure
Compound Properties
SMILES
CCCCOC(=O)[C@@H](CC(=O)C[C@H]([C@H]1CC(=O)[C@@]2([C@]1(C)[C@H](OC(=O)C)C(=O)C1=C2C(=O)C[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C)C
Physicochemical Properties
| Formula |
C36H52O9 |
| Molecular wieght(g/mol) |
628.79 |
| Num. of Heavy atoms |
45 |
| Num. of Aromatic Heavy atoms |
0 |
| Fraction Csp3 |
0.78 |
| Num. of Rotatable bonds |
12 |
| Num. of H-bond acceptors |
9 |
| Num. of H-bonds donors |
1 |
| Molar Refractivity |
169.73 |
| TPSA (square Angstrom) |
141.11 |
Lipophilicity
| iLOGP |
4.29 |
| XLOGP3 |
4.18 |
| WLOGP |
5.14 |
| MLOGP |
2.45 |
| Silicos-IT LOGP |
7.08 |
| Consensus LOGP |
4.63 |
Water Solubility
| ESOL |
|
| LogS |
-5.58 |
Solubility(mg/ml) |
1.65E-03 |
Solubility(mol/l) |
2.63E-06 |
Class |
Moderately soluble |
| Ali |
|
| LogS |
-6.85 |
Solubility(mg/ml) |
8.84E-05 |
Solubility(mol/l) |
1.41E-07 |
Class |
Poorly soluble |
| Silicos-IT |
|
| LogS |
-7.28 |
Solubility(mg/ml) |
3.29E-05 |
Solubility(mol/l) |
5.24E-08 |
Class |
Poorly soluble |
Pharmacokinetics
| GI absorbtion |
Low |
| BBB permeant |
No |
| Pgp substrate |
Yes |
| CYP1A2 inhibitor |
No |
| CYP2C19 inhibitor |
No |
| CYP2C9 inhibitor |
No |
| CYP2D6 inhibitor |
No |
| CYP3A4 inhibitor |
No |
| Log Kp (skin permeation) (cm/s) |
-7.17 |
Druglikeness
| Lipinski Num. violations |
1 |
| Ghose Num. violations |
3 |
| Veber Num. violations |
2 |
| Egan Num. violations |
1 |
| Muegge Num. violations |
1 |
| Bioavailability Score |
0.55 |
Medicinal Chemistry
| PAINS Num. of alerts |
0 |
| Brenk Num. of alerts |
1 |
| Leadlikeness Num. of violations |
3 |
| Synthetic Accessibility |
7.12 |
Biological Activity
| Biological Activity |
JID |
| Antitumour |
7 |
| Anti-HIV |
7 |
| Hypoglycemic |
7 |
| Antiplatelet aggregation |
7 |
| Neuroprotective |
7 |
| Hepatoprotective |
7 |
| Antiobesity |
7 |
