Lucidenic acid C
IUPAC name: (4R)-4-[(3S,5R,7S,10S,12S,13R,14R,17R)-3,7,12-trihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid
CAS Number: 95311-96-9
Class: Terpenoid
Mushrooms contain this compound
1 mushrooms
| MushID |
Thai name |
Common name |
Scientific name |
Family |
| 1 |
เห็ดหลินจือ |
Lingzhi |
Ganoderma lucidum ( Curtis ) P. Karst. |
Ganodermataceae |
2D Structure
Compound Properties
SMILES
OC(=O)CC[C@H]([C@H]1CC(=O)[C@@]2([C@]1(C)[C@H](O)C(=O)C1=C2[C@@H](O)C[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)C
Physicochemical Properties
| Formula |
C27H40O7 |
| Molecular wieght(g/mol) |
476.60 |
| Num. of Heavy atoms |
34 |
| Num. of Aromatic Heavy atoms |
0 |
| Fraction Csp3 |
0.81 |
| Num. of Rotatable bonds |
4 |
| Num. of H-bond acceptors |
7 |
| Num. of H-bonds donors |
4 |
| Molar Refractivity |
127.59 |
| TPSA (square Angstrom) |
132.13 |
Lipophilicity
| iLOGP |
2.37 |
| XLOGP3 |
1.85 |
| WLOGP |
2.90 |
| MLOGP |
1.76 |
| Silicos-IT LOGP |
3.48 |
| Consensus LOGP |
2.47 |
Water Solubility
| ESOL |
|
| LogS |
-3.70 |
Solubility(mg/ml) |
9.59E-02 |
Solubility(mol/l) |
2.01E-04 |
Class |
Soluble |
| Ali |
|
| LogS |
-4.25 |
Solubility(mg/ml) |
2.71E-02 |
Solubility(mol/l) |
5.68E-05 |
Class |
Moderately soluble |
| Silicos-IT |
|
| LogS |
-3.82 |
Solubility(mg/ml) |
7.16E-02 |
Solubility(mol/l) |
1.50E-04 |
Class |
Soluble |
Pharmacokinetics
| GI absorbtion |
High |
| BBB permeant |
No |
| Pgp substrate |
Yes |
| CYP1A2 inhibitor |
No |
| CYP2C19 inhibitor |
No |
| CYP2C9 inhibitor |
No |
| CYP2D6 inhibitor |
No |
| CYP3A4 inhibitor |
Yes |
| Log Kp (skin permeation) (cm/s) |
-7.89 |
Druglikeness
| Lipinski Num. violations |
0 |
| Ghose Num. violations |
1 |
| Veber Num. violations |
0 |
| Egan Num. violations |
1 |
| Muegge Num. violations |
0 |
| Bioavailability Score |
0.56 |
Medicinal Chemistry
| PAINS Num. of alerts |
0 |
| Brenk Num. of alerts |
0 |
| Leadlikeness Num. of violations |
1 |
| Synthetic Accessibility |
6.27 |
Biological Activity
| Biological Activity |
JID |
| Antitumour |
6 |
| Anti-angiogenic |
6 |
| Anti-HIV |
6 |
| Antihistaminic |
6 |
| Anti hepatotoxic |
6 |
| Complement inhibition |
6 |
| Hypocholesterolemic |
6 |
| Antiplatelet aggregation |
6 |
