4-Methylproline
IUPAC name: 4-methylpyrrolidine-2-carboxylic acid
CAS Number: 3005-85-4
Class: Amino acid
Mushrooms contain this compound
1 mushrooms
| MushID |
Thai name |
Common name |
Scientific name |
Family |
| 3 |
เห็ดแครง |
Spit gills |
Schizophyllum commune Fr. |
Schizophyllaceae |
2D Structure
Compound Properties
SMILES
C[C@H]1C[C@@H](NC1)C(=O)O
Physicochemical Properties
| Formula |
C6H11NO2 |
| Molecular wieght(g/mol) |
129.16 |
| Num. of Heavy atoms |
9 |
| Num. of Aromatic Heavy atoms |
0 |
| Fraction Csp3 |
0.83 |
| Num. of Rotatable bonds |
1 |
| Num. of H-bond acceptors |
3 |
| Num. of H-bonds donors |
2 |
| Molar Refractivity |
37.33 |
| TPSA (square Angstrom) |
49.33 |
Lipophilicity
| iLOGP |
0.85 |
| XLOGP3 |
-1.93 |
| WLOGP |
-0.31 |
| MLOGP |
-2.21 |
| Silicos-IT LOGP |
0.20 |
| Consensus LOGP |
-0.68 |
Water Solubility
| ESOL |
|
| LogS |
0.64 |
Solubility(mg/ml) |
5.65E+02 |
Solubility(mol/l) |
4.38E+00 |
Class |
Highly soluble |
| Ali |
|
| LogS |
1.42 |
Solubility(mg/ml) |
3.36E+03 |
Solubility(mol/l) |
2.60E+01 |
Class |
Highly soluble |
| Silicos-IT |
|
| LogS |
-0.30 |
Solubility(mg/ml) |
6.44E+01 |
Solubility(mol/l) |
4.99E-01 |
Class |
Soluble |
Pharmacokinetics
| GI absorbtion |
High |
| BBB permeant |
No |
| Pgp substrate |
No |
| CYP1A2 inhibitor |
No |
| CYP2C19 inhibitor |
No |
| CYP2C9 inhibitor |
No |
| CYP2D6 inhibitor |
No |
| CYP3A4 inhibitor |
No |
| Log Kp (skin permeation) (cm/s) |
-8.46 |
Druglikeness
| Lipinski Num. violations |
0 |
| Ghose Num. violations |
2 |
| Veber Num. violations |
0 |
| Egan Num. violations |
0 |
| Muegge Num. violations |
1 |
| Bioavailability Score |
0.55 |
Medicinal Chemistry
| PAINS Num. of alerts |
0 |
| Brenk Num. of alerts |
0 |
| Leadlikeness Num. of violations |
1 |
| Synthetic Accessibility |
1.88 |